cas: 82925-02-8 — see every product listed under this CAS number, including other names
4-(2-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)ethyl)aniline, 97% (CAS 82925-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F462624-100MG |
| cas | 82925-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 3220.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]aniline (CAS 82925-02-8) is a chemical compound with the molecular formula C19H24N2O2 and a molecular weight of 312.4 g/mol. IUPAC name: 4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]aniline. InChIKey: DGOOLMGPMIHRFY-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]aniline |
| InChIKey | DGOOLMGPMIHRFY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CN(CCC2=C1)CCC3=CC=C(C=C3)N)OC |
Computed by PubChem (NCBI)