cas: 945006-23-5 — see every product listed under this CAS number, including other names
4-(2-Bromophenoxy)-3-chloroaniline, 95%, 95% (CAS 945006-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AGPT-100mg |
| cas | 945006-23-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1130.00 Pln | |
| Chemat | 250mg | 1845.20 Pln | |
| Chemat | 1g | 3030.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2-bromophenoxy)-3-chloroaniline (CAS 945006-23-5) is a chemical compound with the molecular formula C12H9BrClNO and a molecular weight of 298.56 g/mol. IUPAC name: 4-(2-bromophenoxy)-3-chloroaniline. InChIKey: KGUWRWNTYKRTSG-UHFFFAOYSA-N.
| Molecular formula | C12H9BrClNO |
|---|---|
| Molecular weight | 298.56 g/mol |
| IUPAC name | 4-(2-bromophenoxy)-3-chloroaniline |
| InChIKey | KGUWRWNTYKRTSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C=C(C=C2)N)Cl)Br |
Computed by PubChem (NCBI)