4-(2-Fluoro-5-methoxybenzyl)piperidine hydrochloride, 95%
cas: 1021173-26-1 — see every product listed under this CAS number, including other names
4-(2-Fluoro-5-methoxybenzyl)piperidine hydrochloride, 95% (CAS 1021173-26-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A987763-100mg |
| cas | 1021173-26-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1132.44 Pln | |
| Ambeed | 250mg | 1866.69 Pln | |
| Ambeed | 1g | 4931.62 Pln | |
| BLDpharm | 50mg | 747.54 Pln | |
| BLDpharm | 100mg | 1219.60 Pln | |
| BLDpharm | 250mg | 2008.21 Pln | |
| BLDpharm | 1g | 5312.60 Pln | |
| Chemat | 50mg | 698.00 Pln | |
| Chemat | 100mg | 1139.60 Pln | |
| Chemat | 250mg | 1893.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[(2-fluoro-5-methoxyphenyl)methyl]piperidine;hydrochloride (CAS 1021173-26-1) is a chemical compound with the molecular formula C13H19ClFNO and a molecular weight of 259.75 g/mol. IUPAC name: 4-[(2-fluoro-5-methoxyphenyl)methyl]piperidine;hydrochloride. InChIKey: LMPNEPFUDVRURO-UHFFFAOYSA-N.
| Molecular formula | C13H19ClFNO |
|---|---|
| Molecular weight | 259.75 g/mol |
| IUPAC name | 4-[(2-fluoro-5-methoxyphenyl)methyl]piperidine;hydrochloride |
| InChIKey | LMPNEPFUDVRURO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)F)CC2CCNCC2.Cl |
Computed by PubChem (NCBI)