cas: 454699-37-7 — see every product listed under this CAS number, including other names
4-(2-PYRIDINYL)PYRIMIDINE-2-THIOL (CAS 454699-37-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300893-250MG |
| cas | 454699-37-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1799.38 Pln | |
| Fluorochem | 1g | 3048.94 Pln |
| delivery time | 2-3 weeks |
|---|
6-pyridin-2-yl-1H-pyrimidine-2-thione (CAS 454699-37-7) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: 6-pyridin-2-yl-1H-pyrimidine-2-thione. InChIKey: UPVNBRCSYKXAJY-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 6-pyridin-2-yl-1H-pyrimidine-2-thione |
| InChIKey | UPVNBRCSYKXAJY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=NC(=S)N2 |
Computed by PubChem (NCBI)