cas: 199327-59-8 — see every product listed under this CAS number, including other names
4-(3-((4-Chloro-7-methoxyquinazolin-6-yl)oxy)propyl)morpholine 95+% (CAS 199327-59-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A480867-250mg |
| cas | 199327-59-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2005.75 Pln | |
| Ambeed | 5g | 7584.94 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A480867 |
4-[3-(4-chloro-7-methoxyquinazolin-6-yl)oxypropyl]morpholine (CAS 199327-59-8) is a chemical compound with the molecular formula C16H20ClN3O3 and a molecular weight of 337.80 g/mol. IUPAC name: 4-[3-(4-chloro-7-methoxyquinazolin-6-yl)oxypropyl]morpholine. InChIKey: WCABKKDNOBDPHC-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN3O3 |
|---|---|
| Molecular weight | 337.80 g/mol |
| IUPAC name | 4-[3-(4-chloro-7-methoxyquinazolin-6-yl)oxypropyl]morpholine |
| InChIKey | WCABKKDNOBDPHC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2Cl)OCCCN3CCOCC3 |
Computed by PubChem (NCBI)