cas: 1065074-89-6 — see every product listed under this CAS number, including other names
4-(3-Bromo-5-nitropyridin-2-yl)morpholine, 98% (CAS 1065074-89-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A731717-500g |
| cas | 1065074-89-6 |
| size | 500g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 500g | 6213.36 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| AmBeed | 5g | 239.26 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(3-bromo-5-nitro-2-pyridinyl)morpholine (CAS 1065074-89-6) is a chemical compound with the molecular formula C9H10BrN3O3 and a molecular weight of 288.10 g/mol. IUPAC name: 4-(3-bromo-5-nitro-2-pyridinyl)morpholine. InChIKey: RUDIJMQSMFYHSD-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O3 |
|---|---|
| Molecular weight | 288.10 g/mol |
| IUPAC name | 4-(3-bromo-5-nitro-2-pyridinyl)morpholine |
| InChIKey | RUDIJMQSMFYHSD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=N2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)