cas: 1187928-92-2 — see every product listed under this CAS number, including other names
4-(3-Bromophenyl)-1-methylpiperidine, 95%, 95% (CAS 1187928-92-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103HT-50mg |
| cas | 1187928-92-2 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1269.20 Pln | |
| Chemat | 100mg | 1859.60 Pln | |
| Chemat | 250mg | 2459.60 Pln | |
| Chemat | 500mg | 3664.40 Pln | |
| Chemat | 1g | 6093.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(3-bromophenyl)-1-methylpiperidine (CAS 1187928-92-2) is a chemical compound with the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. IUPAC name: 4-(3-bromophenyl)-1-methylpiperidine. InChIKey: JMHFGTMSPFTBMH-UHFFFAOYSA-N.
| Molecular formula | C12H16BrN |
|---|---|
| Molecular weight | 254.17 g/mol |
| IUPAC name | 4-(3-bromophenyl)-1-methylpiperidine |
| InChIKey | JMHFGTMSPFTBMH-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)