4-(3-Bromophenyl)-6-Phenyldibenzo[b,d]Furan, 97%
cas: 2088537-45-3 — see every product listed under this CAS number, including other names
4-(3-Bromophenyl)-6-Phenyldibenzo[b,d]Furan, 97% (CAS 2088537-45-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F864232-1G |
| cas | 2088537-45-3 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 544.62 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| Ambeed | 25g | 971.12 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 353.23 Pln | |
| BLDpharm | 25g | 1041.88 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 376.40 Pln | |
| Chemat | 25g | 1480.40 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-(3-bromophenyl)-6-phenyldibenzofuran (CAS 2088537-45-3) is a chemical compound with the molecular formula C24H15BrO and a molecular weight of 399.3 g/mol. IUPAC name: 4-(3-bromophenyl)-6-phenyldibenzofuran. InChIKey: QSUPTHBRZMHSGI-UHFFFAOYSA-N.
| Molecular formula | C24H15BrO |
|---|---|
| Molecular weight | 399.3 g/mol |
| IUPAC name | 4-(3-bromophenyl)-6-phenyldibenzofuran |
| InChIKey | QSUPTHBRZMHSGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2OC4=C3C=CC=C4C5=CC(=CC=C5)Br |
Computed by PubChem (NCBI)