CAS 937796-02-6 is the registry number for 4-(3-Bromothien-2-yl)-N-methylbenzylamine, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
1-[4-(3-bromothiophen-2-yl)phenyl]-N-methylmethanamine (CAS 937796-02-6) is a chemical compound with the molecular formula C12H12BrNS and a molecular weight of 282.20 g/mol. IUPAC name: 1-[4-(3-bromothiophen-2-yl)phenyl]-N-methylmethanamine. InChIKey: JAQWWPQIUYWZIC-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNS |
|---|---|
| Molecular weight | 282.20 g/mol |
| IUPAC name | 1-[4-(3-bromothiophen-2-yl)phenyl]-N-methylmethanamine |
| InChIKey | JAQWWPQIUYWZIC-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=C(C=C1)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)