cas: 1196152-63-2 — see every product listed under this CAS number, including other names
4-(3-Chlorophenyl)-1H-pyrazole, 97% (CAS 1196152-63-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 5g, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A434837-50mg |
| cas | 1196152-63-2 |
| size | 50mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 50mg | 1365.49 Pln | |
| AmBeed | 5g | 16149.70 Pln | |
| Fluorochem | 50mg | 919.49 Pln | |
| Fluorochem | 100mg | 1080.89 Pln | |
| Fluorochem | 250mg | 1757.73 Pln | |
| Fluorochem | 500mg | 2799.03 Pln | |
| Fluorochem | 1g | 3585.21 Pln | |
| Fluorochem | 2.5g | 6974.65 Pln | |
| Fluorochem | 5g | 10171.44 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(3-chlorophenyl)-1H-pyrazole (CAS 1196152-63-2) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 4-(3-chlorophenyl)-1H-pyrazole. InChIKey: FCGSNXWYYALGBL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-1H-pyrazole |
| InChIKey | FCGSNXWYYALGBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CNN=C2 |
Computed by PubChem (NCBI)