cas: 864754-19-8 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-thienylmethyl)-1H-pyrazole 95% (CAS 864754-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A425651-100mg |
| cas | 864754-19-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 2111.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A425651 |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(thiophen-2-ylmethyl)pyrazole (CAS 864754-19-8) is a chemical compound with the molecular formula C14H19BN2O2S and a molecular weight of 290.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(thiophen-2-ylmethyl)pyrazole. InChIKey: ANSBFDYOIUZSNT-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2S |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(thiophen-2-ylmethyl)pyrazole |
| InChIKey | ANSBFDYOIUZSNT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC3=CC=CS3 |
Computed by PubChem (NCBI)