cas: 1350426-21-9 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide, 98%, 98% (CAS 1350426-21-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTLY-50mg |
| cas | 1350426-21-9 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 222.80 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1614.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide (CAS 1350426-21-9) is a chemical compound with the molecular formula C14H17BF3NO3 and a molecular weight of 315.10 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide. InChIKey: ZKDADHLPCZLDMA-UHFFFAOYSA-N.
| Molecular formula | C14H17BF3NO3 |
|---|---|
| Molecular weight | 315.10 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzamide |
| InChIKey | ZKDADHLPCZLDMA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)