cas: 1073354-61-6 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile, 98% (CAS 1073354-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691523-100MG |
| cas | 1073354-61-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 1320.39 Pln | |
| Fluorochem | 1g | 3309.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile (CAS 1073354-61-6) is a chemical compound with the molecular formula C11H14BNO2S and a molecular weight of 235.11 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile. InChIKey: HXVZWNQWHLJIAI-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO2S |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile |
| InChIKey | HXVZWNQWHLJIAI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC=C2C#N |
Computed by PubChem (NCBI)