cas: 293311-03-2 — see every product listed under this CAS number, including other names
4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-morpholinium tetrafluoroborate, 98%, 98% (CAS 293311-03-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Y3X-1g |
| cas | 293311-03-2 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 50g | 352.40 Pln | |
| Chemat | 100g | 611.60 Pln | |
| Chemat | 500g | 1968.00 Pln | |
| Chemat | 1kg | 3126.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholin-4-ium tetrafluoroborate (CAS 293311-03-2) is a chemical compound with the molecular formula C9H15BF4N4O3 and a molecular weight of 314.05 g/mol. IUPAC name: 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholin-4-ium tetrafluoroborate. InChIKey: YVIFITBSOZRFGV-UHFFFAOYSA-O.
| Molecular formula | C9H15BF4N4O3 |
|---|---|
| Molecular weight | 314.05 g/mol |
| IUPAC name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholin-4-ium tetrafluoroborate |
| InChIKey | YVIFITBSOZRFGV-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.COC1=NC(=NC(=N1)[NH+]2CCOCC2)OC |
Computed by PubChem (NCBI)