4-(4-(Trifluoromethyl)phenyl)quinoline, 95%
cas: 2230245-31-3 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethyl)phenyl)quinoline, 95% (CAS 2230245-31-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1575227-100mg |
| cas | 2230245-31-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 982.25 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 958.58 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 2028.47 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[4-(trifluoromethyl)phenyl]quinoline (CAS 2230245-31-3) is a chemical compound with the molecular formula C16H10F3N and a molecular weight of 273.25 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenyl]quinoline. InChIKey: ZETGEMRSGTXXGV-UHFFFAOYSA-N.
| Molecular formula | C16H10F3N |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenyl]quinoline |
| InChIKey | ZETGEMRSGTXXGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)