cas: 2376990-29-1 — see every product listed under this CAS number, including other names
4-(4-Aminobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione hydrochloride, 98%, 98% (CAS 2376990-29-1) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12LGTE-5mg |
| cas | 2376990-29-1 |
| size | 5mg |
| availability | 15g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 251.60 Pln | |
| Chemat | 10mg | 314.00 Pln | |
| Chemat | 25mg | 386.00 Pln | |
| Chemat | 50mg | 525.20 Pln | |
| Chemat | 100mg | 808.40 Pln | |
| Chemat | 250mg | 1182.80 Pln | |
| Chemat | 1g | 3131.60 Pln | |
| Chemat | 5g | 8805.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-aminobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride (CAS 2376990-29-1) is a chemical compound with the molecular formula C17H20ClN3O5 and a molecular weight of 381.8 g/mol. IUPAC name: 4-(4-aminobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride. InChIKey: VRXZGWPQXJYEPH-UHFFFAOYSA-N.
| Molecular formula | C17H20ClN3O5 |
|---|---|
| Molecular weight | 381.8 g/mol |
| IUPAC name | 4-(4-aminobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| InChIKey | VRXZGWPQXJYEPH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCCN.Cl |
Computed by PubChem (NCBI)