cas: 16154-69-1 — see every product listed under this CAS number, including other names
4-(4-Benzylpiperazin-1-yl)phenylamine (CAS 16154-69-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VOS-250mg |
| cas | 16154-69-1 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 755.60 Pln |
| delivery time | 3 weeks |
|---|
4-(4-benzylpiperazin-1-yl)aniline (CAS 16154-69-1) is a chemical compound with the molecular formula C17H21N3 and a molecular weight of 267.37 g/mol. IUPAC name: 4-(4-benzylpiperazin-1-yl)aniline. InChIKey: PZWVVLZWQWIEAV-UHFFFAOYSA-N.
| Molecular formula | C17H21N3 |
|---|---|
| Molecular weight | 267.37 g/mol |
| IUPAC name | 4-(4-benzylpiperazin-1-yl)aniline |
| InChIKey | PZWVVLZWQWIEAV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)