cas: 516481-95-1 — see every product listed under this CAS number, including other names
4-(4-Chloro-3-(trifluoromethyl)phenoxy)benzaldehyde, 98% (CAS 516481-95-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1162709-5g |
| cas | 516481-95-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13949.32 Pln | |
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 1164.19 Pln | |
| Fluorochem | 1g | 2601.19 Pln | |
| Fluorochem | 5g | 8005.53 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[4-chloro-3-(trifluoromethyl)phenoxy]benzaldehyde (CAS 516481-95-1) is a chemical compound with the molecular formula C14H8ClF3O2 and a molecular weight of 300.66 g/mol. IUPAC name: 4-[4-chloro-3-(trifluoromethyl)phenoxy]benzaldehyde. InChIKey: PRYWVXRFNZLRKO-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3O2 |
|---|---|
| Molecular weight | 300.66 g/mol |
| IUPAC name | 4-[4-chloro-3-(trifluoromethyl)phenoxy]benzaldehyde |
| InChIKey | PRYWVXRFNZLRKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OC2=CC(=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)