cas: 21928-50-7 — see every product listed under this CAS number, including other names
4-(4-Chloro-3-(trifluoromethyl)phenyl)piperidin-4-ol 97% (CAS 21928-50-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A760898-250mg |
| cas | 21928-50-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 381.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A760898 |
4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol (CAS 21928-50-7) is a chemical compound with the molecular formula C12H13ClF3NO and a molecular weight of 279.68 g/mol. IUPAC name: 4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol. InChIKey: RALRVIPTUXSBPO-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3NO |
|---|---|
| Molecular weight | 279.68 g/mol |
| IUPAC name | 4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol |
| InChIKey | RALRVIPTUXSBPO-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=CC(=C(C=C2)Cl)C(F)(F)F)O |
Computed by PubChem (NCBI)