cas: 873537-27-0 — see every product listed under this CAS number, including other names
4-(4-Ethylpiperazin-1-yl)-3-fluoroaniline, 97% (CAS 873537-27-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A305557-5g |
| cas | 873537-27-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 486.64 Pln | |
| Fluorochem | 5g | 539.41 Pln | |
| Fluorochem | 10g | 862.21 Pln | |
| Fluorochem | 25g | 1643.19 Pln | |
| Fluorochem | 100g | 3939.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-ethylpiperazin-1-yl)-3-fluoroaniline (CAS 873537-27-0) is a chemical compound with the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. IUPAC name: 4-(4-ethylpiperazin-1-yl)-3-fluoroaniline. InChIKey: IRLDCHVGDGNGFK-UHFFFAOYSA-N.
| Molecular formula | C12H18FN3 |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 4-(4-ethylpiperazin-1-yl)-3-fluoroaniline |
| InChIKey | IRLDCHVGDGNGFK-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)