cas: 333988-27-5 — see every product listed under this CAS number, including other names
4-(4-Fluoro-benzenesulfonylmethyl)-piperidine-1-carboxylic acid tert-butyl ester, 98%, 98% (CAS 333988-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJF1-100mg |
| cas | 333988-27-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1250.00 Pln | |
| Chemat | 5g | 4403.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[(4-fluorophenyl)sulfonylmethyl]piperidine-1-carboxylate (CAS 333988-27-5) is a chemical compound with the molecular formula C17H24FNO4S and a molecular weight of 357.4 g/mol. IUPAC name: tert-butyl 4-[(4-fluorophenyl)sulfonylmethyl]piperidine-1-carboxylate. InChIKey: KPYBPJVDPQMCID-UHFFFAOYSA-N.
| Molecular formula | C17H24FNO4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | tert-butyl 4-[(4-fluorophenyl)sulfonylmethyl]piperidine-1-carboxylate |
| InChIKey | KPYBPJVDPQMCID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)