4-(4-Fluorobenzamido)benzene-1-sulfonyl chloride, 95%
cas: 1016713-31-7 — see every product listed under this CAS number, including other names
4-(4-Fluorobenzamido)benzene-1-sulfonyl chloride, 95% (CAS 1016713-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1112230-250mg |
| cas | 1016713-31-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1082.38 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1154.00 Pln | |
| BLDpharm | 100mg | 358.79 Pln | |
| BLDpharm | 250mg | 564.27 Pln | |
| BLDpharm | 1g | 1158.51 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-[(4-fluorobenzoyl)amino]benzenesulfonyl chloride (CAS 1016713-31-7) is a chemical compound with the molecular formula C13H9ClFNO3S and a molecular weight of 313.73 g/mol. IUPAC name: 4-[(4-fluorobenzoyl)amino]benzenesulfonyl chloride. InChIKey: KXFCDHAFJMTJLI-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO3S |
|---|---|
| Molecular weight | 313.73 g/mol |
| IUPAC name | 4-[(4-fluorobenzoyl)amino]benzenesulfonyl chloride |
| InChIKey | KXFCDHAFJMTJLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)