4-(4-Fluorophenyl)quinoline, 95%
cas: 479206-50-3 — see every product listed under this CAS number, including other names
4-(4-Fluorophenyl)quinoline, 95% (CAS 479206-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1575219-100mg |
| cas | 479206-50-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 876.56 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 864.16 Pln | |
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 742.46 Pln | |
| Fluorochem | 1g | 1835.83 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 995.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-fluorophenyl)quinoline (CAS 479206-50-3) is a chemical compound with the molecular formula C15H10FN and a molecular weight of 223.24 g/mol. IUPAC name: 4-(4-fluorophenyl)quinoline. InChIKey: HCOXKPBLTFXOOC-UHFFFAOYSA-N.
| Molecular formula | C15H10FN |
|---|---|
| Molecular weight | 223.24 g/mol |
| IUPAC name | 4-(4-fluorophenyl)quinoline |
| InChIKey | HCOXKPBLTFXOOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)