4-(4-Iodophenoxy)-phenol, 95%
cas: 26002-35-7 — see every product listed under this CAS number, including other names
4-(4-Iodophenoxy)-phenol, 95% (CAS 26002-35-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A712752-250mg |
| cas | 26002-35-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 608.70 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Fluorochem | 1g | 586.27 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 555.03 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-iodophenoxy)phenol (CAS 26002-35-7) is a chemical compound with the molecular formula C12H9IO2 and a molecular weight of 312.10 g/mol. IUPAC name: 4-(4-iodophenoxy)phenol. InChIKey: SEUYXXCZJLHQTO-UHFFFAOYSA-N.
| Molecular formula | C12H9IO2 |
|---|---|
| Molecular weight | 312.10 g/mol |
| IUPAC name | 4-(4-iodophenoxy)phenol |
| InChIKey | SEUYXXCZJLHQTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)