cas: 914610-39-2 — see every product listed under this CAS number, including other names
4-(4-METHYLPIPERAZIN-1-YLSULFONYL)PHENYLBORONIC ACID PINACOL ESTER (CAS 914610-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501904-100MG |
| cas | 914610-39-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 1g | 1028.82 Pln | |
| Fluorochem | 5g | 3153.07 Pln |
| delivery time | 2-3 weeks |
|---|
1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine (CAS 914610-39-2) is a chemical compound with the molecular formula C17H27BN2O4S and a molecular weight of 366.3 g/mol. IUPAC name: 1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine. InChIKey: TZMSTBRAQGYDJI-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O4S |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 1-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine |
| InChIKey | TZMSTBRAQGYDJI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)N3CCN(CC3)C |
Computed by PubChem (NCBI)