CAS 259228-52-9 is the registry number for 4-(4-Methoxyphenyl)pyridine-2,6-dicarboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 1g, 250mg.
4-(4-methoxyphenyl)pyridine-2,6-dicarboxylic acid (CAS 259228-52-9) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. IUPAC name: 4-(4-methoxyphenyl)pyridine-2,6-dicarboxylic acid. InChIKey: DTHXIXSONWAIPQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)pyridine-2,6-dicarboxylic acid |
| InChIKey | DTHXIXSONWAIPQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)