cas: 1034975-61-5 — see every product listed under this CAS number, including other names
4-(4-Methylpiperazin-1-yl)-2-[2,2,2-trifluoro-N-(oxan-4-yl)acetamido]benzoic acid, 97%, 97% (CAS 1034975-61-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HA44-100mg |
| cas | 1034975-61-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 500mg | 371.60 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid (CAS 1034975-61-5) is a chemical compound with the molecular formula C19H24F3N3O4 and a molecular weight of 415.4 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid. InChIKey: FDNXQCAFVGNIPT-UHFFFAOYSA-N.
| Molecular formula | C19H24F3N3O4 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | 4-(4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid |
| InChIKey | FDNXQCAFVGNIPT-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)C(=O)O)N(C3CCOCC3)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)