cas: 70261-82-4 — see every product listed under this CAS number, including other names
4-(4-Methylpiperazin-1-ylmethyl)phenylamine, ≥96%, ≥96% (CAS 70261-82-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116WLT-250mg |
| cas | 70261-82-4 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 362.00 Pln | |
| Chemat | 25g | 750.80 Pln |
| purity | ≥96% |
|---|---|
| delivery time | 3 weeks |
4-[(4-methylpiperazin-1-yl)methyl]aniline (CAS 70261-82-4) is a chemical compound with the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. IUPAC name: 4-[(4-methylpiperazin-1-yl)methyl]aniline. InChIKey: NIXCVBFXLJWUTC-UHFFFAOYSA-N.
| Molecular formula | C12H19N3 |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 4-[(4-methylpiperazin-1-yl)methyl]aniline |
| InChIKey | NIXCVBFXLJWUTC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)