cas: 864685-27-8 — see every product listed under this CAS number, including other names
4-(4-Piperazin-2-yl-phenyl)morpholine, 95+% (CAS 864685-27-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A274784-10g |
| cas | 864685-27-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 7432.81 Pln | |
| AmBeed | 250mg | 538.72 Pln | |
| AmBeed | 5g | 3832.78 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-piperazin-2-ylphenyl)morpholine (CAS 864685-27-8) is a chemical compound with the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. IUPAC name: 4-(4-piperazin-2-ylphenyl)morpholine. InChIKey: RTAZSKWNEMNKGR-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O |
|---|---|
| Molecular weight | 247.34 g/mol |
| IUPAC name | 4-(4-piperazin-2-ylphenyl)morpholine |
| InChIKey | RTAZSKWNEMNKGR-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=C(C=C2)N3CCOCC3 |
Computed by PubChem (NCBI)