cas: 505052-64-2 — see every product listed under this CAS number, including other names
4-(5-Bromo-3-nitropyridin-2-yl)morpholine (CAS 505052-64-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11DACZ-1g |
| cas | 505052-64-2 |
| size | 1g |
| availability | 70.72g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 928.40 Pln | |
| Fluorochem | 1g | 1507.82 Pln |
| delivery time | 3 weeks |
|---|
4-(5-bromo-3-nitro-2-pyridinyl)morpholine (CAS 505052-64-2) is a chemical compound with the molecular formula C9H10BrN3O3 and a molecular weight of 288.10 g/mol. IUPAC name: 4-(5-bromo-3-nitro-2-pyridinyl)morpholine. InChIKey: WWQJIRVJWYMVDK-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O3 |
|---|---|
| Molecular weight | 288.10 g/mol |
| IUPAC name | 4-(5-bromo-3-nitro-2-pyridinyl)morpholine |
| InChIKey | WWQJIRVJWYMVDK-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=N2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)