4-(Acetamidomethyl)-1-methylpyridin-1-ium iodide, 95%
cas: 23974-17-6 — see every product listed under this CAS number, including other names
4-(Acetamidomethyl)-1-methylpyridin-1-ium iodide, 95% (CAS 23974-17-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2739172-250mg |
| cas | 23974-17-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1594.12 Pln | |
| Ambeed | 10g | 2511.94 Pln | |
| Ambeed | 25g | 4948.31 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 536.50 Pln | |
| BLDpharm | 5g | 1713.87 Pln | |
| BLDpharm | 10g | 2702.41 Pln | |
| BLDpharm | 25g | 5329.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-[(1-methylpyridin-1-ium-4-yl)methyl]acetamide iodide (CAS 23974-17-6) is a chemical compound with the molecular formula C9H13IN2O and a molecular weight of 292.12 g/mol. IUPAC name: N-[(1-methylpyridin-1-ium-4-yl)methyl]acetamide iodide. InChIKey: UQIPKDYNPBORPG-UHFFFAOYSA-N.
| Molecular formula | C9H13IN2O |
|---|---|
| Molecular weight | 292.12 g/mol |
| IUPAC name | N-[(1-methylpyridin-1-ium-4-yl)methyl]acetamide iodide |
| InChIKey | UQIPKDYNPBORPG-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC1=CC=[N+](C=C1)C.[I-] |
Computed by PubChem (NCBI)