cas: 146093-46-1 — see every product listed under this CAS number, including other names
4-(Aminoethyl)-1-N-Boc-piperidine, 97% (CAS 146093-46-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 20g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040752-250MG |
| cas | 146093-46-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 20g | 1195.43 Pln | |
| Fluorochem | 25g | 1471.37 Pln | |
| Fluorochem | 50g | 2746.97 Pln | |
| Fluorochem | 100g | 5162.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate (CAS 146093-46-1) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate. InChIKey: LBQDLHPFISVBRU-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate |
| InChIKey | LBQDLHPFISVBRU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCN |
Computed by PubChem (NCBI)