cas: 1523606-35-0 — see every product listed under this CAS number, including other names
4-(Azetidin-3-yl)-2,2-dimethylmorpholine ditrifluoroacetate, 97%, 97% (CAS 1523606-35-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY1L-100mg |
| cas | 1523606-35-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1178.00 Pln | |
| Chemat | 250mg | 1845.20 Pln | |
| Chemat | 500mg | 3035.60 Pln | |
| Chemat | 1g | 4514.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(azetidin-3-yl)-2,2-dimethylmorpholine;bis(2,2,2-trifluoroacetic acid) (CAS 1523606-35-0) is a chemical compound with the molecular formula C13H20F6N2O5 and a molecular weight of 398.30 g/mol. IUPAC name: 4-(azetidin-3-yl)-2,2-dimethylmorpholine;bis(2,2,2-trifluoroacetic acid). InChIKey: HPEJQIBTUNJBCX-UHFFFAOYSA-N.
| Molecular formula | C13H20F6N2O5 |
|---|---|
| Molecular weight | 398.30 g/mol |
| IUPAC name | 4-(azetidin-3-yl)-2,2-dimethylmorpholine;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | HPEJQIBTUNJBCX-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCO1)C2CNC2)C.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)