cas: 1403766-88-0 — see every product listed under this CAS number, including other names
4-(Azetidin-3-yl)piperazin-2-one dihydrochloride, 95%, 95% (CAS 1403766-88-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CAY-1g |
| cas | 1403766-88-0 |
| size | 1g |
| availability | 88g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3251.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(azetidin-3-yl)piperazin-2-one;dihydrochloride (CAS 1403766-88-0) is a chemical compound with the molecular formula C7H15Cl2N3O and a molecular weight of 228.12 g/mol. IUPAC name: 4-(azetidin-3-yl)piperazin-2-one;dihydrochloride. InChIKey: WNIJPEUWMRRWNO-UHFFFAOYSA-N.
| Molecular formula | C7H15Cl2N3O |
|---|---|
| Molecular weight | 228.12 g/mol |
| IUPAC name | 4-(azetidin-3-yl)piperazin-2-one;dihydrochloride |
| InChIKey | WNIJPEUWMRRWNO-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)C2CNC2.Cl.Cl |
Computed by PubChem (NCBI)