cas: 2135339-54-5 — see every product listed under this CAS number, including other names
4-(BOC-AMINO)-3-FLUORO-2-METHYLPHENOL, 98% (CAS 2135339-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F822862-1G |
| cas | 2135339-54-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2684.49 Pln | |
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 1252.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(2-fluoro-4-hydroxy-3-methylphenyl)carbamate (CAS 2135339-54-5) is a chemical compound with the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. IUPAC name: tert-butyl N-(2-fluoro-4-hydroxy-3-methylphenyl)carbamate. InChIKey: AVDDIDIKZWRWSI-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO3 |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | tert-butyl N-(2-fluoro-4-hydroxy-3-methylphenyl)carbamate |
| InChIKey | AVDDIDIKZWRWSI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)