4-(Benzyloxy)-1-bromo-2-chlorobenzene, 95%
cas: 729590-57-2 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-1-bromo-2-chlorobenzene, 95% (CAS 729590-57-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A685761-250mg |
| cas | 729590-57-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 25g | 2484.12 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 497.76 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 253.27 Pln | |
| BLDpharm | 5g | 708.66 Pln | |
| BLDpharm | 25g | 2669.08 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 25g | 4959.73 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-bromo-2-chloro-4-phenylmethoxybenzene (CAS 729590-57-2) is a chemical compound with the molecular formula C13H10BrClO and a molecular weight of 297.57 g/mol. IUPAC name: 1-bromo-2-chloro-4-phenylmethoxybenzene. InChIKey: GBMHQPWNKOXREJ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClO |
|---|---|
| Molecular weight | 297.57 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-phenylmethoxybenzene |
| InChIKey | GBMHQPWNKOXREJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)