cas: 147291-69-8 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)-4-oxobutanoic acid 95% (CAS 147291-69-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A568420-1g |
| cas | 147291-69-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A568420 |
2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid (CAS 147291-69-8) is a chemical compound with the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid. InChIKey: SOHLZANWVLCPHK-UHFFFAOYSA-N.
| Molecular formula | C16H21NO6 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | SOHLZANWVLCPHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)