cas: 60710-40-9 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-2-bromo-1-methylbenzene (CAS 60710-40-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329283-1G |
| cas | 60710-40-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1065.27 Pln | |
| Fluorochem | 5g | 3048.94 Pln |
| delivery time | 3-4 weeks |
|---|
2-bromo-1-methyl-4-phenylmethoxybenzene (CAS 60710-40-9) is a chemical compound with the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. IUPAC name: 2-bromo-1-methyl-4-phenylmethoxybenzene. InChIKey: UENAXUWFESQYML-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 2-bromo-1-methyl-4-phenylmethoxybenzene |
| InChIKey | UENAXUWFESQYML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)