cas: 17903-89-8 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3-nitrobenzoic acid (CAS 17903-89-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F727670-250MG |
| cas | 17903-89-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 851.80 Pln | |
| Fluorochem | 1g | 1533.85 Pln |
| delivery time | 3-4 weeks |
|---|
3-nitro-4-phenylmethoxybenzoic acid (CAS 17903-89-8) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. IUPAC name: 3-nitro-4-phenylmethoxybenzoic acid. InChIKey: ZPGYWCMZSUFFFM-UHFFFAOYSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 3-nitro-4-phenylmethoxybenzoic acid |
| InChIKey | ZPGYWCMZSUFFFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)