cas: 1251732-64-5 — see every product listed under this CAS number, including other names
4-(Boc-amino)-1-cyclohexene-1-boronic Acid Pinacol Ester, 98%, 98% (CAS 1251732-64-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NAK-100mg |
| cas | 1251732-64-5 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 4197.20 Pln | |
| Chemat | 250g | 7437.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate (CAS 1251732-64-5) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate. InChIKey: BQDDQHLYCAQNMX-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate |
| InChIKey | BQDDQHLYCAQNMX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)