cas: 1215118-94-7 — see every product listed under this CAS number, including other names
4-(Chloromethyl)-1-isopropoxy-2-(trifluoromethyl)benzene, 97%, 97% (CAS 1215118-94-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g, 15g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K65B-250mg |
| cas | 1215118-94-7 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 10g | 1034.00 Pln | |
| Chemat | 15g | 1480.40 Pln | |
| Chemat | 25g | 2229.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(chloromethyl)-1-propan-2-yloxy-2-(trifluoromethyl)benzene (CAS 1215118-94-7) is a chemical compound with the molecular formula C11H12ClF3O and a molecular weight of 252.66 g/mol. IUPAC name: 4-(chloromethyl)-1-propan-2-yloxy-2-(trifluoromethyl)benzene. InChIKey: SKOIWBPVBTURJZ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF3O |
|---|---|
| Molecular weight | 252.66 g/mol |
| IUPAC name | 4-(chloromethyl)-1-propan-2-yloxy-2-(trifluoromethyl)benzene |
| InChIKey | SKOIWBPVBTURJZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)CCl)C(F)(F)F |
Computed by PubChem (NCBI)