4-(Cyclopropylamino)-2-((4-(4-(ethylsulfonyl)piperazin-1-yl)phenyl)amino)pyrimidine-5-carboxamide, 98%
cas: 1198300-79-6 — see every product listed under this CAS number, including other names
4-(Cyclopropylamino)-2-((4-(4-(ethylsulfonyl)piperazin-1-yl)phenyl)amino)pyrimidine-5-carboxamide, 98% (CAS 1198300-79-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch119TF2-1mg |
| cas | 1198300-79-6 |
| size | 1mg |
| availability | 1.016g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 136.40 Pln | |
| Chemat | 5mg | 184.40 Pln | |
| Chemat | 10mg | 208.40 Pln | |
| Chemat | 25mg | 400.40 Pln | |
| Chemat | 50mg | 510.80 Pln | |
| Chemat | 100mg | 822.80 Pln | |
| Chemat | 250mg | 1350.80 Pln | |
| Chemat | 1g | 3544.40 Pln | |
| BLDpharm | 1mg | 197.73 Pln | |
| BLDpharm | 5mg | 369.89 Pln | |
| BLDpharm | 10mg | 525.40 Pln | |
| BLDpharm | 50mg | 769.75 Pln | |
| BLDpharm | 100mg | 1252.92 Pln | |
| BLDpharm | 250mg | 2074.85 Pln | |
| BLDpharm | 1g | 5479.21 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(cyclopropylamino)-2-[4-(4-ethylsulfonylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (CAS 1198300-79-6) is a chemical compound with the molecular formula C20H27N7O3S and a molecular weight of 445.5 g/mol. IUPAC name: 4-(cyclopropylamino)-2-[4-(4-ethylsulfonylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide. InChIKey: BGLPECHZZQDNCD-UHFFFAOYSA-N.
| Molecular formula | C20H27N7O3S |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | 4-(cyclopropylamino)-2-[4-(4-ethylsulfonylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| InChIKey | BGLPECHZZQDNCD-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4CC4)C(=O)N |
Computed by PubChem (NCBI)