cas: 1369882-54-1 — see every product listed under this CAS number, including other names
4-(Cyclopropylmethoxy)-2-fluorobenzonitrile, 95%, 95% (CAS 1369882-54-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12RCZW-100mg |
| cas | 1369882-54-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 933.20 Pln | |
| Chemat | 1g | 2243.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(cyclopropylmethoxy)-2-fluorobenzonitrile (CAS 1369882-54-1) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: 4-(cyclopropylmethoxy)-2-fluorobenzonitrile. InChIKey: LAOUOBJQLCNVOJ-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | 4-(cyclopropylmethoxy)-2-fluorobenzonitrile |
| InChIKey | LAOUOBJQLCNVOJ-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)