cas: 65619-20-7 — see every product listed under this CAS number, including other names
4-(DIMETHYLAMINO)-4-PHENYLCYCLOHEXAN-1-ONE, 98% (CAS 65619-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504970-100MG |
| cas | 65619-20-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 500mg | 955.93 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 5g | 4038.18 Pln | |
| Fluorochem | 10g | 6688.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(dimethylamino)-4-phenylcyclohexan-1-one (CAS 65619-20-7) is a chemical compound with the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. IUPAC name: 4-(dimethylamino)-4-phenylcyclohexan-1-one. InChIKey: DEOPEYZZVGZQFC-UHFFFAOYSA-N.
| Molecular formula | C14H19NO |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | 4-(dimethylamino)-4-phenylcyclohexan-1-one |
| InChIKey | DEOPEYZZVGZQFC-UHFFFAOYSA-N |
| SMILES | CN(C)C1(CCC(=O)CC1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)