cas: 57771-09-2 — see every product listed under this CAS number, including other names
4-(Dibutylamino)-2-hydroxybenzaldehyde, 98% (CAS 57771-09-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F774684-5G |
| cas | 57771-09-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1190.22 Pln | |
| Fluorochem | 25g | 2700.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(dibutylamino)-2-hydroxybenzaldehyde (CAS 57771-09-2) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. IUPAC name: 4-(dibutylamino)-2-hydroxybenzaldehyde. InChIKey: BWHGDPKOFVNGFQ-UHFFFAOYSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | 4-(dibutylamino)-2-hydroxybenzaldehyde |
| InChIKey | BWHGDPKOFVNGFQ-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C1=CC(=C(C=C1)C=O)O |
Computed by PubChem (NCBI)