4-(Dimethylsulfamoyl)benzene-1-sulfonyl chloride 95%
cas: 677782-39-7 — see every product listed under this CAS number, including other names
4-(Dimethylsulfamoyl)benzene-1-sulfonyl chloride 95% (CAS 677782-39-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A340511-100mg |
| cas | 677782-39-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 859.88 Pln | |
| Ambeed | 1g | 2345.06 Pln | |
| Ambeed | 5g | 6555.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A340511 |
4-(dimethylsulfamoyl)benzenesulfonyl chloride (CAS 677782-39-7) is a chemical compound with the molecular formula C8H10ClNO4S2 and a molecular weight of 283.8 g/mol. IUPAC name: 4-(dimethylsulfamoyl)benzenesulfonyl chloride. InChIKey: MONMTDYGPKNEOH-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO4S2 |
|---|---|
| Molecular weight | 283.8 g/mol |
| IUPAC name | 4-(dimethylsulfamoyl)benzenesulfonyl chloride |
| InChIKey | MONMTDYGPKNEOH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(dimethylsulfamoyl)benzene-1-sulfonyl chloride, 4-(dimethylsulfamoyl)benzenesulfonyl Chloride, 4-[(dimethylamino)sulfonyl]benzenesulfonyl chloride, 4-(N,N-dimethylsulfamoyl)benzenesulfonyl chloride, Benzenesulfonyl chloride, 4-[(dimethylamino)sulfonyl]-, 4-(dimethylsulfamoyl)benzene-1-sulfonylchloride, 4-[(dimethylamino)sulfonyl]benzenesulfonyl chloride, AldrichCPR