cas: 124915-06-6 — see every product listed under this CAS number, including other names
4-(Ethoxycarbonyl)-N,N,N-trimethylbenzenaminium trifluoromethanesulfonate, 95%, 95% (CAS 124915-06-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111MVT-100mg |
| cas | 124915-06-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 1720.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-ethoxycarbonylphenyl)-trimethylazanium;trifluoromethanesulfonate (CAS 124915-06-6) is a chemical compound with the molecular formula C13H18F3NO5S and a molecular weight of 357.35 g/mol. IUPAC name: (4-ethoxycarbonylphenyl)-trimethylazanium;trifluoromethanesulfonate. InChIKey: WLRXPMQGBKYWNJ-UHFFFAOYSA-M.
| Molecular formula | C13H18F3NO5S |
|---|---|
| Molecular weight | 357.35 g/mol |
| IUPAC name | (4-ethoxycarbonylphenyl)-trimethylazanium;trifluoromethanesulfonate |
| InChIKey | WLRXPMQGBKYWNJ-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=CC=C(C=C1)[N+](C)(C)C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)