cas: 60456-77-1 — see every product listed under this CAS number, including other names
4-(Furan-2-yl)benzaldehyde 98% (CAS 60456-77-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A625952-100mg |
| cas | 60456-77-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 687.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A625952 |
4-(furan-2-yl)benzaldehyde (CAS 60456-77-1) is a chemical compound with the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. IUPAC name: 4-(furan-2-yl)benzaldehyde. InChIKey: WBUXKMOCVYRVES-UHFFFAOYSA-N.
| Molecular formula | C11H8O2 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 4-(furan-2-yl)benzaldehyde |
| InChIKey | WBUXKMOCVYRVES-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)