CAS 33963-58-5 appears in our catalog under these names: Etoricoxib Impurity 36, 4-Methanesulfinylbenzoic acid, 95%, 95%, 4-Methanesulfinylbenzoic acid, 95+%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-methylsulfinylbenzoic acid (CAS 33963-58-5) is a chemical compound with the molecular formula C8H8O3S and a molecular weight of 184.21 g/mol. IUPAC name: 4-methylsulfinylbenzoic acid. InChIKey: DTKRTQFUPNGBLZ-UHFFFAOYSA-N.
| Molecular formula | C8H8O3S |
|---|---|
| Molecular weight | 184.21 g/mol |
| IUPAC name | 4-methylsulfinylbenzoic acid |
| InChIKey | DTKRTQFUPNGBLZ-UHFFFAOYSA-N |
| SMILES | CS(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)