CAS 175202-92-3 is the registry number for 4-(Methylthio)-6-pyrazin-2-yl-1,3,5-triazin-2-amine, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g.
4-methylsulfanyl-6-pyrazin-2-yl-1,3,5-triazin-2-amine (CAS 175202-92-3) is a chemical compound with the molecular formula C8H8N6S and a molecular weight of 220.26 g/mol. IUPAC name: 4-methylsulfanyl-6-pyrazin-2-yl-1,3,5-triazin-2-amine. InChIKey: SQOSJKISJKSCMM-UHFFFAOYSA-N.
| Molecular formula | C8H8N6S |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 4-methylsulfanyl-6-pyrazin-2-yl-1,3,5-triazin-2-amine |
| InChIKey | SQOSJKISJKSCMM-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=NC(=N1)N)C2=NC=CN=C2 |
Computed by PubChem (NCBI)